C14H10Cl2N2O3S — CID 134106967
2-(2,4-dichlorophenyl)-1,1-dioxo-3-pyridin-2-yl-2H-1,3-thiazol-4-ol (PubChem CID 134106967) has the molecular formula C14H10Cl2N2O3S and a molecular weight of 357.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1,1-dioxo-3-pyridin-2-yl-2H-1,3-thiazol-4-ol.
| Compound Name | 2-(2,4-dichlorophenyl)-1,1-dioxo-3-pyridin-2-yl-2H-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 134106967 |
| Molecular Formula | C14H10Cl2N2O3S |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1,1-dioxo-3-pyridin-2-yl-2H-1,3-thiazol-4-ol |
| SMILES | O=S1(=O)C=C(O)N(c2ccccn2)C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H10Cl2N2O3S/c15-9-4-5-10(11(16)7-9)14-18(12-3-1-2-6-17-12)13(19)8-22(14,20)21/h1-8,14,19H |
| InChIKey | BMALCCHXNVCKCD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |