About 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione
4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione (PubChem CID 134107103) has the molecular formula C10H8ClNS2
and a molecular weight of 241.77 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione |
| PubChem CID | 134107103 |
| Molecular Formula | C10H8ClNS2 |
| Molecular Weight | 241.77 g/mol |
| Exact Mass | 240.98 |
| IUPAC Name | 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione |
| SMILES | Cn1c(-c2cccc(Cl)c2)csc1=S |
| InChI | InChI=1S/C10H8ClNS2/c1-12-9(6-14-10(12)13)7-3-2-4-8(11)5-7/h2-6H,1H3 |
| InChIKey | AQSSAFLOKWQHOT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.77 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione?
The IUPAC name of 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione (CID 134107103) is 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione.
What is the SMILES notation for 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione?
The canonical SMILES for 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione is Cn1c(-c2cccc(Cl)c2)csc1=S.
What is the InChIKey of 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione?
The InChIKey is AQSSAFLOKWQHOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNS2/c1-12-9(6-14-10(12)13)7-3-2-4-8(11)5-7/h2-6H,1H3.
What are the key properties of 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione?
4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione has a molecular weight of 241.77 g/mol, XLogP of 4.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chlorophenyl)-3-methyl-1,3-thiazole-2-thione is sourced from PubChem (CID 134107103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).