C11H15N2O6- — CID 134107216
(1Z,3E)-2,4-dicarbamoyl-1,5-diethoxy-5-oxopenta-1,3-dien-1-olate (PubChem CID 134107216) has the molecular formula C11H15N2O6- and a molecular weight of 271.25 g/mol. Its IUPAC name is (1Z,3E)-2,4-dicarbamoyl-1,5-diethoxy-5-oxopenta-1,3-dien-1-olate.
| Compound Name | (1Z,3E)-2,4-dicarbamoyl-1,5-diethoxy-5-oxopenta-1,3-dien-1-olate |
|---|---|
| PubChem CID | 134107216 |
| Molecular Formula | C11H15N2O6- |
| Molecular Weight | 271.25 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (1Z,3E)-2,4-dicarbamoyl-1,5-diethoxy-5-oxopenta-1,3-dien-1-olate |
| SMILES | CCOC(=O)/C(=C/C(C(N)=O)=C(\[O-])OCC)C(N)=O |
| InChI | InChI=1S/C11H16N2O6/c1-3-18-10(16)6(8(12)14)5-7(9(13)15)11(17)19-4-2/h5,16H,3-4H2,1-2H3,(H2,12,14)(H2,13,15)/p-1/b7-5+,10-6- |
| InChIKey | DSQIKDOSFUKGMY-ZUVZAJTGSA-M |
| XLogP | -1.95 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.25 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|