C17H31N2O7P — CID 134109853
ethyl 4-amino-2-[2-[di(propan-2-yl)amino]ethoxy]benzoate;phosphoric acid (PubChem CID 134109853) has the molecular formula C17H31N2O7P and a molecular weight of 406.42 g/mol. Its IUPAC name is ethyl 4-amino-2-[2-[di(propan-2-yl)amino]ethoxy]benzoate;phosphoric acid.
| Compound Name | ethyl 4-amino-2-[2-[di(propan-2-yl)amino]ethoxy]benzoate;phosphoric acid |
|---|---|
| PubChem CID | 134109853 |
| Molecular Formula | C17H31N2O7P |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | ethyl 4-amino-2-[2-[di(propan-2-yl)amino]ethoxy]benzoate;phosphoric acid |
| SMILES | CCOC(=O)c1ccc(N)cc1OCCN(C(C)C)C(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C17H28N2O3.H3O4P/c1-6-21-17(20)15-8-7-14(18)11-16(15)22-10-9-19(12(2)3)13(4)5;1-5(2,3)4/h7-8,11-13H,6,9-10,18H2,1-5H3;(H3,1,2,3,4) |
| InChIKey | KENKBSHPZCHHOH-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|