About [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate
[(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate (PubChem CID 24996028) has the molecular formula C16H26N2O3
and a molecular weight of 294.39 g/mol. Its IUPAC name is [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate.
Molecular Properties
| Compound Name | [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate |
| PubChem CID | 24996028 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate |
| SMILES | CCCCOc1cc(N)ccc1C(=O)OC[C@H](C)N(C)C |
| InChI | InChI=1S/C16H26N2O3/c1-5-6-9-20-15-10-13(17)7-8-14(15)16(19)21-11-12(2)18(3)4/h7-8,10,12H,5-6,9,11,17H2,1-4H3/t12-/m0/s1 |
| InChIKey | AAWOXZBPZGTYAC-LBPRGKRZSA-N |
| XLogP | 2.55 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate?
The IUPAC name of [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate (CID 24996028) is [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate.
What is the SMILES notation for [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate?
The canonical SMILES for [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate is CCCCOc1cc(N)ccc1C(=O)OC[C@H](C)N(C)C.
What is the InChIKey of [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate?
The InChIKey is AAWOXZBPZGTYAC-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H26N2O3/c1-5-6-9-20-15-10-13(17)7-8-14(15)16(19)21-11-12(2)18(3)4/h7-8,10,12H,5-6,9,11,17H2,1-4H3/t12-/m0/s1.
What are the key properties of [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate?
[(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate has a molecular weight of 294.39 g/mol, XLogP of 2.55, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-(dimethylamino)propyl] 4-amino-2-butoxybenzoate is sourced from PubChem (CID 24996028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).