C17H28N2O3 — CID 59226348
[(2S)-2-(dimethylamino)-3-methylbutyl] 4-amino-2-propoxybenzoate (PubChem CID 59226348) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is [(2S)-2-(dimethylamino)-3-methylbutyl] 4-amino-2-propoxybenzoate.
| Compound Name | [(2S)-2-(dimethylamino)-3-methylbutyl] 4-amino-2-propoxybenzoate |
|---|---|
| PubChem CID | 59226348 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | [(2S)-2-(dimethylamino)-3-methylbutyl] 4-amino-2-propoxybenzoate |
| SMILES | CCCOc1cc(N)ccc1C(=O)OC[C@H](C(C)C)N(C)C |
| InChI | InChI=1S/C17H28N2O3/c1-6-9-21-16-10-13(18)7-8-14(16)17(20)22-11-15(12(2)3)19(4)5/h7-8,10,12,15H,6,9,11,18H2,1-5H3/t15-/m1/s1 |
| InChIKey | VOHSYDNUCTZXBG-OAHLLOKOSA-N |
| XLogP | 2.80 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|