C21H34N2O3 — CID 143615994
[1-(diethylamino)-2-ethyl-3-methylcyclopropyl]methyl 4-amino-2-propoxybenzoate (PubChem CID 143615994) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is [1-(diethylamino)-2-ethyl-3-methylcyclopropyl]methyl 4-amino-2-propoxybenzoate.
| Compound Name | [1-(diethylamino)-2-ethyl-3-methylcyclopropyl]methyl 4-amino-2-propoxybenzoate |
|---|---|
| PubChem CID | 143615994 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | [1-(diethylamino)-2-ethyl-3-methylcyclopropyl]methyl 4-amino-2-propoxybenzoate |
| SMILES | CCCOc1cc(N)ccc1C(=O)OCC1(N(CC)CC)C(C)C1CC |
| InChI | InChI=1S/C21H34N2O3/c1-6-12-25-19-13-16(22)10-11-17(19)20(24)26-14-21(23(8-3)9-4)15(5)18(21)7-2/h10-11,13,15,18H,6-9,12,14,22H2,1-5H3 |
| InChIKey | JHAJAPOUZYPWNK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|