C17H16Cl2N2O2S — CID 134110263
2-(1,3-benzothiazol-2-yl)-4,5-dichlorobenzoate;propan-2-ylazanium (PubChem CID 134110263) has the molecular formula C17H16Cl2N2O2S and a molecular weight of 383.30 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-4,5-dichlorobenzoate;propan-2-ylazanium.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-4,5-dichlorobenzoate;propan-2-ylazanium |
|---|---|
| PubChem CID | 134110263 |
| Molecular Formula | C17H16Cl2N2O2S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-4,5-dichlorobenzoate;propan-2-ylazanium |
| SMILES | CC(C)[NH3+].O=C([O-])c1cc(Cl)c(Cl)cc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C14H7Cl2NO2S.C3H9N/c15-9-5-7(8(14(18)19)6-10(9)16)13-17-11-3-1-2-4-12(11)20-13;1-3(2)4/h1-6H,(H,18,19);3H,4H2,1-2H3 |
| InChIKey | VDVJZQOKKUEZQR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |