C16H23ClN2O4 — CID 134110400
2-morpholin-4-yl-1-(2,3,5,6-tetramethyl-4-nitrophenyl)ethanone;hydrochloride (PubChem CID 134110400) has the molecular formula C16H23ClN2O4 and a molecular weight of 342.82 g/mol. Its IUPAC name is 2-morpholin-4-yl-1-(2,3,5,6-tetramethyl-4-nitrophenyl)ethanone;hydrochloride.
| Compound Name | 2-morpholin-4-yl-1-(2,3,5,6-tetramethyl-4-nitrophenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 134110400 |
| Molecular Formula | C16H23ClN2O4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-morpholin-4-yl-1-(2,3,5,6-tetramethyl-4-nitrophenyl)ethanone;hydrochloride |
| SMILES | Cc1c(C)c([N+](=O)[O-])c(C)c(C)c1C(=O)CN1CCOCC1.Cl |
| InChI | InChI=1S/C16H22N2O4.ClH/c1-10-12(3)16(18(20)21)13(4)11(2)15(10)14(19)9-17-5-7-22-8-6-17;/h5-9H2,1-4H3;1H |
| InChIKey | MBAVDVKHYYPFDO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|