C16H13ClF3N3O2S — CID 134112085
1-[[2-(3-chlorophenyl)sulfanylacetyl]amino]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 134112085) has the molecular formula C16H13ClF3N3O2S and a molecular weight of 403.81 g/mol. Its IUPAC name is 1-[[2-(3-chlorophenyl)sulfanylacetyl]amino]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[[2-(3-chlorophenyl)sulfanylacetyl]amino]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 134112085 |
| Molecular Formula | C16H13ClF3N3O2S |
| Molecular Weight | 403.81 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 1-[[2-(3-chlorophenyl)sulfanylacetyl]amino]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(CSc1cccc(Cl)c1)NNC(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13ClF3N3O2S/c17-11-4-2-6-13(8-11)26-9-14(24)22-23-15(25)21-12-5-1-3-10(7-12)16(18,19)20/h1-8H,9H2,(H,22,24)(H2,21,23,25) |
| InChIKey | ZIGHPOXHSHBVJR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.81 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|