C11H14Cl2N4O — CID 134113157
N-[2-[[amino-(2,4-dichloroanilino)methylidene]amino]ethyl]acetamide (PubChem CID 134113157) has the molecular formula C11H14Cl2N4O and a molecular weight of 289.17 g/mol. Its IUPAC name is N-[2-[[amino-(2,4-dichloroanilino)methylidene]amino]ethyl]acetamide.
| Compound Name | N-[2-[[amino-(2,4-dichloroanilino)methylidene]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 134113157 |
| Molecular Formula | C11H14Cl2N4O |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | N-[2-[[amino-(2,4-dichloroanilino)methylidene]amino]ethyl]acetamide |
| SMILES | CC(=O)NCC/N=C(\N)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N4O/c1-7(18)15-4-5-16-11(14)17-10-3-2-8(12)6-9(10)13/h2-3,6H,4-5H2,1H3,(H,15,18)(H3,14,16,17) |
| InChIKey | QMZGWDPOWKEGCI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|