C16H22F2N2O3 — CID 134113386
tert-butyl N-tert-butyl-N-[(3,5-difluorobenzoyl)amino]carbamate (PubChem CID 134113386) has the molecular formula C16H22F2N2O3 and a molecular weight of 328.36 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[(3,5-difluorobenzoyl)amino]carbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[(3,5-difluorobenzoyl)amino]carbamate |
|---|---|
| PubChem CID | 134113386 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[(3,5-difluorobenzoyl)amino]carbamate |
| SMILES | CC(C)(C)OC(=O)N(NC(=O)c1cc(F)cc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C16H22F2N2O3/c1-15(2,3)20(14(22)23-16(4,5)6)19-13(21)10-7-11(17)9-12(18)8-10/h7-9H,1-6H3,(H,19,21) |
| InChIKey | IYHVZVXAGBZNBZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|