About N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide
N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide (PubChem CID 67922013) has the molecular formula C16H19FN2O2
and a molecular weight of 290.34 g/mol. Its IUPAC name is N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide.
Molecular Properties
| Compound Name | N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide |
| PubChem CID | 67922013 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide |
| SMILES | CCC#CC(=O)N(NC(=O)c1cccc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C16H19FN2O2/c1-5-6-10-14(20)19(16(2,3)4)18-15(21)12-8-7-9-13(17)11-12/h7-9,11H,5H2,1-4H3,(H,18,21) |
| InChIKey | KMXXZWOAHYJJST-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide?
The IUPAC name of N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide (CID 67922013) is N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide.
What is the SMILES notation for N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide?
The canonical SMILES for N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide is CCC#CC(=O)N(NC(=O)c1cccc(F)c1)C(C)(C)C.
What is the InChIKey of N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide?
The InChIKey is KMXXZWOAHYJJST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19FN2O2/c1-5-6-10-14(20)19(16(2,3)4)18-15(21)12-8-7-9-13(17)11-12/h7-9,11H,5H2,1-4H3,(H,18,21).
What are the key properties of N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide?
N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide has a molecular weight of 290.34 g/mol, XLogP of 2.51, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-tert-butyl-3-fluoro-N'-pent-2-ynoylbenzohydrazide is sourced from PubChem (CID 67922013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).