C15H19FN2O2 — CID 67922185
N'-but-3-enoyl-N-tert-butyl-3-fluorobenzohydrazide (PubChem CID 67922185) has the molecular formula C15H19FN2O2 and a molecular weight of 278.33 g/mol. Its IUPAC name is N'-but-3-enoyl-N-tert-butyl-3-fluorobenzohydrazide.
| Compound Name | N'-but-3-enoyl-N-tert-butyl-3-fluorobenzohydrazide |
|---|---|
| PubChem CID | 67922185 |
| Molecular Formula | C15H19FN2O2 |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | N'-but-3-enoyl-N-tert-butyl-3-fluorobenzohydrazide |
| SMILES | C=CCC(=O)NN(C(=O)c1cccc(F)c1)C(C)(C)C |
| InChI | InChI=1S/C15H19FN2O2/c1-5-7-13(19)17-18(15(2,3)4)14(20)11-8-6-9-12(16)10-11/h5-6,8-10H,1,7H2,2-4H3,(H,17,19) |
| InChIKey | LWBCOXQMSICNKT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|