C15H14FN5 — CID 134113555
1-(4-fluorophenyl)-2-phenyl-2H-1,3,5-triazine-4,6-diamine (PubChem CID 134113555) has the molecular formula C15H14FN5 and a molecular weight of 283.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-phenyl-2H-1,3,5-triazine-4,6-diamine.
| Compound Name | 1-(4-fluorophenyl)-2-phenyl-2H-1,3,5-triazine-4,6-diamine |
|---|---|
| PubChem CID | 134113555 |
| Molecular Formula | C15H14FN5 |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-(4-fluorophenyl)-2-phenyl-2H-1,3,5-triazine-4,6-diamine |
| SMILES | NC1=NC(c2ccccc2)N(c2ccc(F)cc2)C(N)=N1 |
| InChI | InChI=1S/C15H14FN5/c16-11-6-8-12(9-7-11)21-13(10-4-2-1-3-5-10)19-14(17)20-15(21)18/h1-9,13H,(H4,17,18,19,20) |
| InChIKey | DPSCXAIXGBBHFD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |