C12H13N3OS — CID 134113848
1-[4-amino-2-(N-methylanilino)-1,3-thiazol-5-yl]ethanone (PubChem CID 134113848) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 1-[4-amino-2-(N-methylanilino)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[4-amino-2-(N-methylanilino)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 134113848 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 1-[4-amino-2-(N-methylanilino)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1sc(N(C)c2ccccc2)nc1N |
| InChI | InChI=1S/C12H13N3OS/c1-8(16)10-11(13)14-12(17-10)15(2)9-6-4-3-5-7-9/h3-7H,13H2,1-2H3 |
| InChIKey | HIBVWBIRLSQMPS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |