C13H12N2O3S — CID 69134146
(5-acetyl-4-methyl-1,3-thiazol-2-yl)-phenylcarbamic acid (PubChem CID 69134146) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is (5-acetyl-4-methyl-1,3-thiazol-2-yl)-phenylcarbamic acid.
| Compound Name | (5-acetyl-4-methyl-1,3-thiazol-2-yl)-phenylcarbamic acid |
|---|---|
| PubChem CID | 69134146 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | (5-acetyl-4-methyl-1,3-thiazol-2-yl)-phenylcarbamic acid |
| SMILES | CC(=O)c1sc(N(C(=O)O)c2ccccc2)nc1C |
| InChI | InChI=1S/C13H12N2O3S/c1-8-11(9(2)16)19-12(14-8)15(13(17)18)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,17,18) |
| InChIKey | KABPXQZTNKOPNV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |