C6H6BrNOS — CID 66644881
1-(2-bromo-4-methyl-1,3-thiazol-5-yl)ethanone (PubChem CID 66644881) has the molecular formula C6H6BrNOS and a molecular weight of 220.09 g/mol. Its IUPAC name is 1-(2-bromo-4-methyl-1,3-thiazol-5-yl)ethanone.
| Compound Name | 1-(2-bromo-4-methyl-1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 66644881 |
| Molecular Formula | C6H6BrNOS |
| Molecular Weight | 220.09 g/mol |
| Exact Mass | 218.94 |
| IUPAC Name | 1-(2-bromo-4-methyl-1,3-thiazol-5-yl)ethanone |
| SMILES | CC(=O)c1sc(Br)nc1C |
| InChI | InChI=1S/C6H6BrNOS/c1-3-5(4(2)9)10-6(7)8-3/h1-2H3 |
| InChIKey | RZEIEXBCYWPGCZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.09 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |