C18H16N2OS — CID 17391570
1-[4-methyl-2-(N-phenylanilino)-1,3-thiazol-5-yl]ethanone (PubChem CID 17391570) has the molecular formula C18H16N2OS and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-[4-methyl-2-(N-phenylanilino)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[4-methyl-2-(N-phenylanilino)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 17391570 |
| Molecular Formula | C18H16N2OS |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 1-[4-methyl-2-(N-phenylanilino)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1sc(N(c2ccccc2)c2ccccc2)nc1C |
| InChI | InChI=1S/C18H16N2OS/c1-13-17(14(2)21)22-18(19-13)20(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,1-2H3 |
| InChIKey | GNZXXURKNZRRCR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |