(4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid

C12H12N2O2S — CID 118954162

IUPAC(4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid
SMILESCc1nc(N(C(=O)O)c2ccccc2)sc1C
InChIInChI=1S/C12H12N2O2S/c1-8-9(2)17-11(13-8)14(12(15)16)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,15,16)
InChIKeyLLBSYMUGXUEIAV-UHFFFAOYSA-N
MW248.31 g/mol
LogP3.58
Rot. Bonds2

About (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid

(4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid (PubChem CID 118954162) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid.

Molecular Properties

Compound Name(4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid
PubChem CID118954162
Molecular FormulaC12H12N2O2S
Molecular Weight248.31 g/mol
Exact Mass248.06
IUPAC Name(4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid
SMILESCc1nc(N(C(=O)O)c2ccccc2)sc1C
InChIInChI=1S/C12H12N2O2S/c1-8-9(2)17-11(13-8)14(12(15)16)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,15,16)
InChIKeyLLBSYMUGXUEIAV-UHFFFAOYSA-N
XLogP3.58
TPSA53.43 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.31
LogP ≤ 53.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid?
The IUPAC name of (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid (CID 118954162) is (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid.
What is the SMILES notation for (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid?
The canonical SMILES for (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid is Cc1nc(N(C(=O)O)c2ccccc2)sc1C.
What is the InChIKey of (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid?
The InChIKey is LLBSYMUGXUEIAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2S/c1-8-9(2)17-11(13-8)14(12(15)16)10-6-4-3-5-7-10/h3-7H,1-2H3,(H,15,16).
What are the key properties of (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid?
(4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid has a molecular weight of 248.31 g/mol, XLogP of 3.58, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dimethyl-1,3-thiazol-2-yl)-phenylcarbamic acid is sourced from PubChem (CID 118954162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).