C17H16N4O3 — CID 134114694
ethyl 3-(4,6-dimethylpyrimidin-2-yl)oxyquinoxaline-2-carboxylate (PubChem CID 134114694) has the molecular formula C17H16N4O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is ethyl 3-(4,6-dimethylpyrimidin-2-yl)oxyquinoxaline-2-carboxylate.
| Compound Name | ethyl 3-(4,6-dimethylpyrimidin-2-yl)oxyquinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 134114694 |
| Molecular Formula | C17H16N4O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | ethyl 3-(4,6-dimethylpyrimidin-2-yl)oxyquinoxaline-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2nc1Oc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C17H16N4O3/c1-4-23-16(22)14-15(21-13-8-6-5-7-12(13)20-14)24-17-18-10(2)9-11(3)19-17/h5-9H,4H2,1-3H3 |
| InChIKey | GBDRPISECWCAGO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 87.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |