C33H29ClN6O7 — CID 158776977
ethyl 3-chloroquinoxaline-2-carboxylate;ethyl 3-methoxyquinoxaline-2-carboxylate;3-methoxyquinoxaline-2-carbaldehyde (PubChem CID 158776977) has the molecular formula C33H29ClN6O7 and a molecular weight of 657.08 g/mol. Its IUPAC name is ethyl 3-chloroquinoxaline-2-carboxylate;ethyl 3-methoxyquinoxaline-2-carboxylate;3-methoxyquinoxaline-2-carbaldehyde.
| Compound Name | ethyl 3-chloroquinoxaline-2-carboxylate;ethyl 3-methoxyquinoxaline-2-carboxylate;3-methoxyquinoxaline-2-carbaldehyde |
|---|---|
| PubChem CID | 158776977 |
| Molecular Formula | C33H29ClN6O7 |
| Molecular Weight | 657.08 g/mol |
| Exact Mass | 656.18 |
| IUPAC Name | ethyl 3-chloroquinoxaline-2-carboxylate;ethyl 3-methoxyquinoxaline-2-carboxylate;3-methoxyquinoxaline-2-carbaldehyde |
| SMILES | CCOC(=O)c1nc2ccccc2nc1Cl.CCOC(=O)c1nc2ccccc2nc1OC.COc1nc2ccccc2nc1C=O |
| InChI | InChI=1S/C12H12N2O3.C11H9ClN2O2.C10H8N2O2/c1-3-17-12(15)10-11(16-2)14-9-7-5-4-6-8(9)13-10;1-2-16-11(15)9-10(12)14-8-6-4-3-5-7(8)13-9;1-14-10-9(6-13)11-7-4-2-3-5-8(7)12-10/h4-7H,3H2,1-2H3;3-6H,2H2,1H3;2-6H,1H3 |
| InChIKey | IQOXUMLVPXBVFB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 165.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.08 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|