C13H10F3IN2O4 — CID 134115870
3-(4-iodo-3,5-dimethoxyphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione (PubChem CID 134115870) has the molecular formula C13H10F3IN2O4 and a molecular weight of 442.13 g/mol. Its IUPAC name is 3-(4-iodo-3,5-dimethoxyphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 3-(4-iodo-3,5-dimethoxyphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 134115870 |
| Molecular Formula | C13H10F3IN2O4 |
| Molecular Weight | 442.13 g/mol |
| Exact Mass | 441.96 |
| IUPAC Name | 3-(4-iodo-3,5-dimethoxyphenyl)-6-(trifluoromethyl)-1H-pyrimidine-2,4-dione |
| SMILES | COc1cc(-n2c(=O)cc(C(F)(F)F)[nH]c2=O)cc(OC)c1I |
| InChI | InChI=1S/C13H10F3IN2O4/c1-22-7-3-6(4-8(23-2)11(7)17)19-10(20)5-9(13(14,15)16)18-12(19)21/h3-5H,1-2H3,(H,18,21) |
| InChIKey | FJGVAXCSVAORER-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.13 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|