C25H29NO2 — CID 134116312
benzyl 3-(4-tert-butylphenyl)-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate (PubChem CID 134116312) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is benzyl 3-(4-tert-butylphenyl)-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate.
| Compound Name | benzyl 3-(4-tert-butylphenyl)-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 134116312 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | benzyl 3-(4-tert-butylphenyl)-2-azabicyclo[2.2.2]oct-5-ene-2-carboxylate |
| SMILES | CC(C)(C)c1ccc(C2C3C=CC(CC3)N2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H29NO2/c1-25(2,3)21-13-9-19(10-14-21)23-20-11-15-22(16-12-20)26(23)24(27)28-17-18-7-5-4-6-8-18/h4-11,13-15,20,22-23H,12,16-17H2,1-3H3 |
| InChIKey | SUBUBHBWIFMHGH-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|