C18H33N2O6PS — CID 134119127
S-[2-(diethylamino)ethyl] 4-(5-hydroxypentylamino)benzenecarbothioate;phosphoric acid (PubChem CID 134119127) has the molecular formula C18H33N2O6PS and a molecular weight of 436.51 g/mol. Its IUPAC name is S-[2-(diethylamino)ethyl] 4-(5-hydroxypentylamino)benzenecarbothioate;phosphoric acid.
| Compound Name | S-[2-(diethylamino)ethyl] 4-(5-hydroxypentylamino)benzenecarbothioate;phosphoric acid |
|---|---|
| PubChem CID | 134119127 |
| Molecular Formula | C18H33N2O6PS |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | S-[2-(diethylamino)ethyl] 4-(5-hydroxypentylamino)benzenecarbothioate;phosphoric acid |
| SMILES | CCN(CC)CCSC(=O)c1ccc(NCCCCCO)cc1.O=P(O)(O)O |
| InChI | InChI=1S/C18H30N2O2S.H3O4P/c1-3-20(4-2)13-15-23-18(22)16-8-10-17(11-9-16)19-12-6-5-7-14-21;1-5(2,3)4/h8-11,19,21H,3-7,12-15H2,1-2H3;(H3,1,2,3,4) |
| InChIKey | AZTASVIAMJQDSZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 130.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|