C13H21BrN3O2PS2 — CID 134119818
1-(4-bromo-2-methylphenyl)-3-[diethoxyphosphinothioyl(methyl)amino]thiourea (PubChem CID 134119818) has the molecular formula C13H21BrN3O2PS2 and a molecular weight of 426.34 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-3-[diethoxyphosphinothioyl(methyl)amino]thiourea.
| Compound Name | 1-(4-bromo-2-methylphenyl)-3-[diethoxyphosphinothioyl(methyl)amino]thiourea |
|---|---|
| PubChem CID | 134119818 |
| Molecular Formula | C13H21BrN3O2PS2 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-3-[diethoxyphosphinothioyl(methyl)amino]thiourea |
| SMILES | CCOP(=S)(OCC)N(C)NC(=S)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C13H21BrN3O2PS2/c1-5-18-20(22,19-6-2)17(4)16-13(21)15-12-8-7-11(14)9-10(12)3/h7-9H,5-6H2,1-4H3,(H2,15,16,21) |
| InChIKey | WHZFRTZAYUJNJF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 45.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|