C16H24N4OSi — CID 134120551
6-ethyl-5-[3-(trimethylsilylmethyl)phenoxy]pyrimidine-2,4-diamine (PubChem CID 134120551) has the molecular formula C16H24N4OSi and a molecular weight of 316.48 g/mol. Its IUPAC name is 6-ethyl-5-[3-(trimethylsilylmethyl)phenoxy]pyrimidine-2,4-diamine.
| Compound Name | 6-ethyl-5-[3-(trimethylsilylmethyl)phenoxy]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134120551 |
| Molecular Formula | C16H24N4OSi |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 6-ethyl-5-[3-(trimethylsilylmethyl)phenoxy]pyrimidine-2,4-diamine |
| SMILES | CCc1nc(N)nc(N)c1Oc1cccc(C[Si](C)(C)C)c1 |
| InChI | InChI=1S/C16H24N4OSi/c1-5-13-14(15(17)20-16(18)19-13)21-12-8-6-7-11(9-12)10-22(2,3)4/h6-9H,5,10H2,1-4H3,(H4,17,18,19,20) |
| InChIKey | ACBUAERLWABTNX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|