C10H15ClO2 — CID 13412093
(2S,3S)-3-chloro-4-methyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one (PubChem CID 13412093) has the molecular formula C10H15ClO2 and a molecular weight of 202.68 g/mol. Its IUPAC name is (2S,3S)-3-chloro-4-methyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one.
| Compound Name | (2S,3S)-3-chloro-4-methyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 13412093 |
| Molecular Formula | C10H15ClO2 |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | (2S,3S)-3-chloro-4-methyl-2-(2-methylpropyl)-2,3-dihydropyran-6-one |
| SMILES | CC1=CC(=O)O[C@@H](CC(C)C)[C@H]1Cl |
| InChI | InChI=1S/C10H15ClO2/c1-6(2)4-8-10(11)7(3)5-9(12)13-8/h5-6,8,10H,4H2,1-3H3/t8-,10-/m0/s1 |
| InChIKey | QFDHCZMCQIXYIK-WPRPVWTQSA-N |
| XLogP | 2.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|