C10H13Cl3O2 — CID 102321841
(2S)-4-tert-butyl-2-(trichloromethyl)-2,3-dihydropyran-6-one (PubChem CID 102321841) has the molecular formula C10H13Cl3O2 and a molecular weight of 271.57 g/mol. Its IUPAC name is (2S)-4-tert-butyl-2-(trichloromethyl)-2,3-dihydropyran-6-one.
| Compound Name | (2S)-4-tert-butyl-2-(trichloromethyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 102321841 |
| Molecular Formula | C10H13Cl3O2 |
| Molecular Weight | 271.57 g/mol |
| Exact Mass | 270.00 |
| IUPAC Name | (2S)-4-tert-butyl-2-(trichloromethyl)-2,3-dihydropyran-6-one |
| SMILES | CC(C)(C)C1=CC(=O)O[C@H](C(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C10H13Cl3O2/c1-9(2,3)6-4-7(10(11,12)13)15-8(14)5-6/h5,7H,4H2,1-3H3/t7-/m0/s1 |
| InChIKey | GHYNIXCNZWRWRL-ZETCQYMHSA-N |
| XLogP | 3.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.57 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|