C9H11Cl3O2 — CID 16752835
(2S)-4-propan-2-yl-2-(trichloromethyl)-2,3-dihydropyran-6-one (PubChem CID 16752835) has the molecular formula C9H11Cl3O2 and a molecular weight of 257.54 g/mol. Its IUPAC name is (2S)-4-propan-2-yl-2-(trichloromethyl)-2,3-dihydropyran-6-one.
| Compound Name | (2S)-4-propan-2-yl-2-(trichloromethyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 16752835 |
| Molecular Formula | C9H11Cl3O2 |
| Molecular Weight | 257.54 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | (2S)-4-propan-2-yl-2-(trichloromethyl)-2,3-dihydropyran-6-one |
| SMILES | CC(C)C1=CC(=O)O[C@H](C(Cl)(Cl)Cl)C1 |
| InChI | InChI=1S/C9H11Cl3O2/c1-5(2)6-3-7(9(10,11)12)14-8(13)4-6/h4-5,7H,3H2,1-2H3/t7-/m0/s1 |
| InChIKey | RYIYPOXNRKMHAM-ZETCQYMHSA-N |
| XLogP | 3.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|