C11H16Cl2O2 — CID 121006491
(2S)-4-tert-butyl-2-(1,1-dichloroethyl)-2,3-dihydropyran-6-one (PubChem CID 121006491) has the molecular formula C11H16Cl2O2 and a molecular weight of 251.15 g/mol. Its IUPAC name is (2S)-4-tert-butyl-2-(1,1-dichloroethyl)-2,3-dihydropyran-6-one.
| Compound Name | (2S)-4-tert-butyl-2-(1,1-dichloroethyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 121006491 |
| Molecular Formula | C11H16Cl2O2 |
| Molecular Weight | 251.15 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | (2S)-4-tert-butyl-2-(1,1-dichloroethyl)-2,3-dihydropyran-6-one |
| SMILES | CC(C)(C)C1=CC(=O)O[C@H](C(C)(Cl)Cl)C1 |
| InChI | InChI=1S/C11H16Cl2O2/c1-10(2,3)7-5-8(11(4,12)13)15-9(14)6-7/h6,8H,5H2,1-4H3/t8-/m0/s1 |
| InChIKey | WMLWQBXDUGAABO-QMMMGPOBSA-N |
| XLogP | 3.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.15 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|