C19H26O5 — CID 134121286
1-(5-hydroxy-2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromen-6-yl)-2-methoxyethanone (PubChem CID 134121286) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 1-(5-hydroxy-2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromen-6-yl)-2-methoxyethanone.
| Compound Name | 1-(5-hydroxy-2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromen-6-yl)-2-methoxyethanone |
|---|---|
| PubChem CID | 134121286 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-(5-hydroxy-2,2,8,8-tetramethyl-3,4,9,10-tetrahydropyrano[2,3-f]chromen-6-yl)-2-methoxyethanone |
| SMILES | COCC(=O)c1c(O)c2c(c3c1OC(C)(C)CC3)OC(C)(C)CC2 |
| InChI | InChI=1S/C19H26O5/c1-18(2)8-6-11-15(21)14(13(20)10-22-5)17-12(16(11)23-18)7-9-19(3,4)24-17/h21H,6-10H2,1-5H3 |
| InChIKey | YLZGCGMZKXJOHX-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |