C29H40O6 — CID 159523428
6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromene-5-carbaldehyde;2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 159523428) has the molecular formula C29H40O6 and a molecular weight of 484.63 g/mol. Its IUPAC name is 6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromene-5-carbaldehyde;2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromene-5-carbaldehyde;2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 159523428 |
| Molecular Formula | C29H40O6 |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.28 |
| IUPAC Name | 6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromene-5-carbaldehyde;2,2,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | COCOc1c(C)c(C)c2c(c1C=O)CCC(C)(C)O2.Cc1c(O)cc2c(c1C)OC(C)(C)CC2 |
| InChI | InChI=1S/C16H22O4.C13H18O2/c1-10-11(2)15-12(6-7-16(3,4)20-15)13(8-17)14(10)19-9-18-5;1-8-9(2)12-10(7-11(8)14)5-6-13(3,4)15-12/h8H,6-7,9H2,1-5H3;7,14H,5-6H2,1-4H3 |
| InChIKey | MCCBEXQPWRAPDY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|