C33H49NO7 — CID 160816738
6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromene-5-carbaldehyde;2-[6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromen-5-yl]ethanamine (PubChem CID 160816738) has the molecular formula C33H49NO7 and a molecular weight of 571.76 g/mol. Its IUPAC name is 6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromene-5-carbaldehyde;2-[6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromen-5-yl]ethanamine.
| Compound Name | 6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromene-5-carbaldehyde;2-[6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromen-5-yl]ethanamine |
|---|---|
| PubChem CID | 160816738 |
| Molecular Formula | C33H49NO7 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.35 |
| IUPAC Name | 6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromene-5-carbaldehyde;2-[6-(methoxymethoxy)-2,2,7,8-tetramethyl-3,4-dihydrochromen-5-yl]ethanamine |
| SMILES | COCOc1c(C)c(C)c2c(c1C=O)CCC(C)(C)O2.COCOc1c(C)c(C)c2c(c1CCN)CCC(C)(C)O2 |
| InChI | InChI=1S/C17H27NO3.C16H22O4/c1-11-12(2)16-13(6-8-17(3,4)21-16)14(7-9-18)15(11)20-10-19-5;1-10-11(2)15-12(6-7-16(3,4)20-15)13(8-17)14(10)19-9-18-5/h6-10,18H2,1-5H3;8H,6-7,9H2,1-5H3 |
| InChIKey | SEZQVQHGEYDUPD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|