C14H13BrF2N4O2 — CID 134121646
1-(4-bromo-5-but-3-yn-2-yloxy-2-fluorophenyl)-4-(3-fluoropropyl)tetrazol-5-one (PubChem CID 134121646) has the molecular formula C14H13BrF2N4O2 and a molecular weight of 387.18 g/mol. Its IUPAC name is 1-(4-bromo-5-but-3-yn-2-yloxy-2-fluorophenyl)-4-(3-fluoropropyl)tetrazol-5-one.
| Compound Name | 1-(4-bromo-5-but-3-yn-2-yloxy-2-fluorophenyl)-4-(3-fluoropropyl)tetrazol-5-one |
|---|---|
| PubChem CID | 134121646 |
| Molecular Formula | C14H13BrF2N4O2 |
| Molecular Weight | 387.18 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | 1-(4-bromo-5-but-3-yn-2-yloxy-2-fluorophenyl)-4-(3-fluoropropyl)tetrazol-5-one |
| SMILES | C#CC(C)Oc1cc(-n2nnn(CCCF)c2=O)c(F)cc1Br |
| InChI | InChI=1S/C14H13BrF2N4O2/c1-3-9(2)23-13-8-12(11(17)7-10(13)15)21-14(22)20(18-19-21)6-4-5-16/h1,7-9H,4-6H2,2H3 |
| InChIKey | SWKCPJFHLUIAOX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|