C13H18FN5O2 — CID 152806543
1-[2-(2-aminoethoxy)-4-fluoro-5-propan-2-ylphenyl]-4-methyltetrazol-5-one (PubChem CID 152806543) has the molecular formula C13H18FN5O2 and a molecular weight of 295.32 g/mol. Its IUPAC name is 1-[2-(2-aminoethoxy)-4-fluoro-5-propan-2-ylphenyl]-4-methyltetrazol-5-one.
| Compound Name | 1-[2-(2-aminoethoxy)-4-fluoro-5-propan-2-ylphenyl]-4-methyltetrazol-5-one |
|---|---|
| PubChem CID | 152806543 |
| Molecular Formula | C13H18FN5O2 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-[2-(2-aminoethoxy)-4-fluoro-5-propan-2-ylphenyl]-4-methyltetrazol-5-one |
| SMILES | CC(C)c1cc(-n2nnn(C)c2=O)c(OCCN)cc1F |
| InChI | InChI=1S/C13H18FN5O2/c1-8(2)9-6-11(19-13(20)18(3)16-17-19)12(7-10(9)14)21-5-4-15/h6-8H,4-5,15H2,1-3H3 |
| InChIKey | SPPMGQGDXXBFNO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 87.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |