C19H28N2O5S — CID 134122672
1-[2-[1-(1,3-benzodioxol-5-ylsulfonyl)pyrrolidin-2-yl]ethyl]-4-methyl-1-oxidopiperidin-1-ium (PubChem CID 134122672) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[2-[1-(1,3-benzodioxol-5-ylsulfonyl)pyrrolidin-2-yl]ethyl]-4-methyl-1-oxidopiperidin-1-ium.
| Compound Name | 1-[2-[1-(1,3-benzodioxol-5-ylsulfonyl)pyrrolidin-2-yl]ethyl]-4-methyl-1-oxidopiperidin-1-ium |
|---|---|
| PubChem CID | 134122672 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 1-[2-[1-(1,3-benzodioxol-5-ylsulfonyl)pyrrolidin-2-yl]ethyl]-4-methyl-1-oxidopiperidin-1-ium |
| SMILES | CC1CC[N+]([O-])(CCC2CCCN2S(=O)(=O)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C19H28N2O5S/c1-15-6-10-21(22,11-7-15)12-8-16-3-2-9-20(16)27(23,24)17-4-5-18-19(13-17)26-14-25-18/h4-5,13,15-16H,2-3,6-12,14H2,1H3 |
| InChIKey | YFGOGINLDHGOPH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|