C11H7Cl3NNaO3 — CID 134122959
sodium (Z)-2,3-dichloro-4-(3-chloro-4-methylanilino)-4-oxobut-2-enoate (PubChem CID 134122959) has the molecular formula C11H7Cl3NNaO3 and a molecular weight of 330.53 g/mol. Its IUPAC name is sodium (Z)-2,3-dichloro-4-(3-chloro-4-methylanilino)-4-oxobut-2-enoate.
| Compound Name | sodium (Z)-2,3-dichloro-4-(3-chloro-4-methylanilino)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 134122959 |
| Molecular Formula | C11H7Cl3NNaO3 |
| Molecular Weight | 330.53 g/mol |
| Exact Mass | 328.94 |
| IUPAC Name | sodium (Z)-2,3-dichloro-4-(3-chloro-4-methylanilino)-4-oxobut-2-enoate |
| SMILES | Cc1ccc(NC(=O)/C(Cl)=C(/Cl)C(=O)[O-])cc1Cl.[Na+] |
| InChI | InChI=1S/C11H8Cl3NO3.Na/c1-5-2-3-6(4-7(5)12)15-10(16)8(13)9(14)11(17)18;/h2-4H,1H3,(H,15,16)(H,17,18);/q;+1/p-1/b9-8-; |
| InChIKey | PTJMISMHSIIZEN-UOQXYWCXSA-M |
| XLogP | -0.97 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.53 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|