C13H14Cl2N2O2 — CID 15592611
(Z)-2,3-dichloro-N-(3,4-dimethylphenyl)-N'-methylbut-2-enediamide (PubChem CID 15592611) has the molecular formula C13H14Cl2N2O2 and a molecular weight of 301.17 g/mol. Its IUPAC name is (Z)-2,3-dichloro-N-(3,4-dimethylphenyl)-N'-methylbut-2-enediamide.
| Compound Name | (Z)-2,3-dichloro-N-(3,4-dimethylphenyl)-N'-methylbut-2-enediamide |
|---|---|
| PubChem CID | 15592611 |
| Molecular Formula | C13H14Cl2N2O2 |
| Molecular Weight | 301.17 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | (Z)-2,3-dichloro-N-(3,4-dimethylphenyl)-N'-methylbut-2-enediamide |
| SMILES | CNC(=O)/C(Cl)=C(/Cl)C(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C13H14Cl2N2O2/c1-7-4-5-9(6-8(7)2)17-13(19)11(15)10(14)12(18)16-3/h4-6H,1-3H3,(H,16,18)(H,17,19)/b11-10- |
| InChIKey | BVUKXBYWQROAPC-KHPPLWFESA-N |
| XLogP | 2.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.17 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|