C21H25N5O3 — CID 134126623
5-[4-(2-methylpropyl)phenyl]-N-[(E)-(4-nitrophenyl)methylideneamino]pyrazolidine-3-carboxamide (PubChem CID 134126623) has the molecular formula C21H25N5O3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 5-[4-(2-methylpropyl)phenyl]-N-[(E)-(4-nitrophenyl)methylideneamino]pyrazolidine-3-carboxamide.
| Compound Name | 5-[4-(2-methylpropyl)phenyl]-N-[(E)-(4-nitrophenyl)methylideneamino]pyrazolidine-3-carboxamide |
|---|---|
| PubChem CID | 134126623 |
| Molecular Formula | C21H25N5O3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 5-[4-(2-methylpropyl)phenyl]-N-[(E)-(4-nitrophenyl)methylideneamino]pyrazolidine-3-carboxamide |
| SMILES | CC(C)Cc1ccc(C2CC(C(=O)N/N=C/c3ccc([N+](=O)[O-])cc3)NN2)cc1 |
| InChI | InChI=1S/C21H25N5O3/c1-14(2)11-15-3-7-17(8-4-15)19-12-20(24-23-19)21(27)25-22-13-16-5-9-18(10-6-16)26(28)29/h3-10,13-14,19-20,23-24H,11-12H2,1-2H3,(H,25,27)/b22-13+ |
| InChIKey | CNGSLTKFGPHJMR-LPYMAVHISA-N |
| XLogP | 2.85 |
| TPSA | 108.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|