C11H20ClNO2 — CID 134128339
2-[4-(aminomethyl)-1-bicyclo[2.2.2]octanyl]acetic acid;hydrochloride (PubChem CID 134128339) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-1-bicyclo[2.2.2]octanyl]acetic acid;hydrochloride.
| Compound Name | 2-[4-(aminomethyl)-1-bicyclo[2.2.2]octanyl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 134128339 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-[4-(aminomethyl)-1-bicyclo[2.2.2]octanyl]acetic acid;hydrochloride |
| SMILES | Cl.NCC12CCC(CC(=O)O)(CC1)CC2 |
| InChI | InChI=1S/C11H19NO2.ClH/c12-8-11-4-1-10(2-5-11,3-6-11)7-9(13)14;/h1-8,12H2,(H,13,14);1H |
| InChIKey | WNTAQSDEZRIKPY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |