C23H31N3O4 — CID 134130402
N-[(E)-[4-(diethoxymethyl)phenyl]methylideneamino]-4-[2-(dimethylamino)ethoxy]benzamide (PubChem CID 134130402) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[(E)-[4-(diethoxymethyl)phenyl]methylideneamino]-4-[2-(dimethylamino)ethoxy]benzamide.
| Compound Name | N-[(E)-[4-(diethoxymethyl)phenyl]methylideneamino]-4-[2-(dimethylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 134130402 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | N-[(E)-[4-(diethoxymethyl)phenyl]methylideneamino]-4-[2-(dimethylamino)ethoxy]benzamide |
| SMILES | CCOC(OCC)c1ccc(/C=N/NC(=O)c2ccc(OCCN(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H31N3O4/c1-5-28-23(29-6-2)20-9-7-18(8-10-20)17-24-25-22(27)19-11-13-21(14-12-19)30-16-15-26(3)4/h7-14,17,23H,5-6,15-16H2,1-4H3,(H,25,27)/b24-17+ |
| InChIKey | QHEZPPCHTPVDEB-JJIBRWJFSA-N |
| XLogP | 3.46 |
| TPSA | 72.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|