C8H18N4O2S — CID 134133363
(2R)-2-amino-2-[2-(diaminomethylideneamino)ethylsulfanylmethyl]butanoic acid (PubChem CID 134133363) has the molecular formula C8H18N4O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is (2R)-2-amino-2-[2-(diaminomethylideneamino)ethylsulfanylmethyl]butanoic acid.
| Compound Name | (2R)-2-amino-2-[2-(diaminomethylideneamino)ethylsulfanylmethyl]butanoic acid |
|---|---|
| PubChem CID | 134133363 |
| Molecular Formula | C8H18N4O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | (2R)-2-amino-2-[2-(diaminomethylideneamino)ethylsulfanylmethyl]butanoic acid |
| SMILES | CC[C@](N)(CSCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C8H18N4O2S/c1-2-8(11,6(13)14)5-15-4-3-12-7(9)10/h2-5,11H2,1H3,(H,13,14)(H4,9,10,12)/t8-/m0/s1 |
| InChIKey | IKVQMUODLVUKII-QMMMGPOBSA-N |
| XLogP | -0.81 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|