C11H7Cl2N3O4 — CID 134135917
N-(2,5-dichlorophenyl)-2,4,6-trioxo-1,3-diazinane-5-carboxamide (PubChem CID 134135917) has the molecular formula C11H7Cl2N3O4 and a molecular weight of 316.10 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2,4,6-trioxo-1,3-diazinane-5-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
|---|---|
| PubChem CID | 134135917 |
| Molecular Formula | C11H7Cl2N3O4 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2,4,6-trioxo-1,3-diazinane-5-carboxamide |
| SMILES | O=C1NC(=O)C(C(=O)Nc2cc(Cl)ccc2Cl)C(=O)N1 |
| InChI | InChI=1S/C11H7Cl2N3O4/c12-4-1-2-5(13)6(3-4)14-8(17)7-9(18)15-11(20)16-10(7)19/h1-3,7H,(H,14,17)(H2,15,16,18,19,20) |
| InChIKey | CRUPFCJBBUFNFR-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|