C8H6Cl2N2O2 — CID 6409669
(2Z)-N-(2,5-dichlorophenyl)-2-hydroxyiminoacetamide (PubChem CID 6409669) has the molecular formula C8H6Cl2N2O2 and a molecular weight of 233.05 g/mol. Its IUPAC name is (2Z)-N-(2,5-dichlorophenyl)-2-hydroxyiminoacetamide.
| Compound Name | (2Z)-N-(2,5-dichlorophenyl)-2-hydroxyiminoacetamide |
|---|---|
| PubChem CID | 6409669 |
| Molecular Formula | C8H6Cl2N2O2 |
| Molecular Weight | 233.05 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | (2Z)-N-(2,5-dichlorophenyl)-2-hydroxyiminoacetamide |
| SMILES | O=C(/C=N\O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H6Cl2N2O2/c9-5-1-2-6(10)7(3-5)12-8(13)4-11-14/h1-4,14H,(H,12,13)/b11-4- |
| InChIKey | QHQMDDDKRFDIOT-WCIBSUBMSA-N |
| XLogP | 2.39 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.05 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|