C11H9Cl2NO3 — CID 82335576
(E)-4-(2,5-dichloroanilino)-2-methyl-4-oxobut-2-enoic acid (PubChem CID 82335576) has the molecular formula C11H9Cl2NO3 and a molecular weight of 274.10 g/mol. Its IUPAC name is (E)-4-(2,5-dichloroanilino)-2-methyl-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2,5-dichloroanilino)-2-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 82335576 |
| Molecular Formula | C11H9Cl2NO3 |
| Molecular Weight | 274.10 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | (E)-4-(2,5-dichloroanilino)-2-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C\C(=O)Nc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H9Cl2NO3/c1-6(11(16)17)4-10(15)14-9-5-7(12)2-3-8(9)13/h2-5H,1H3,(H,14,15)(H,16,17)/b6-4+ |
| InChIKey | JHAGCQVWNGRCRY-GQCTYLIASA-N |
| XLogP | 2.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.10 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|