C23H39NO — CID 134139794
(3R,8R,9S,10S,13S,14S,16R,17E)-3-(ethylamino)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-ol (PubChem CID 134139794) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is (3R,8R,9S,10S,13S,14S,16R,17E)-3-(ethylamino)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-ol.
| Compound Name | (3R,8R,9S,10S,13S,14S,16R,17E)-3-(ethylamino)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-ol |
|---|---|
| PubChem CID | 134139794 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | (3R,8R,9S,10S,13S,14S,16R,17E)-3-(ethylamino)-17-ethylidene-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-16-ol |
| SMILES | C/C=C1/[C@H](O)C[C@H]2[C@@H]3CCC4C[C@H](NCC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C23H39NO/c1-5-18-21(25)14-20-17-8-7-15-13-16(24-6-2)9-11-22(15,3)19(17)10-12-23(18,20)4/h5,15-17,19-21,24-25H,6-14H2,1-4H3/b18-5-/t15?,16-,17-,19+,20+,21-,22+,23-/m1/s1 |
| InChIKey | YKSSCHLSKKEPGG-GVWFNHNYSA-N |
| XLogP | 4.92 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|