C23H37NO2 — CID 147830950
N-[(3R,10S,13S,16R,17E)-17-ethylidene-16-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]acetamide (PubChem CID 147830950) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is N-[(3R,10S,13S,16R,17E)-17-ethylidene-16-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]acetamide.
| Compound Name | N-[(3R,10S,13S,16R,17E)-17-ethylidene-16-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]acetamide |
|---|---|
| PubChem CID | 147830950 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | N-[(3R,10S,13S,16R,17E)-17-ethylidene-16-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl]acetamide |
| SMILES | C/C=C1/[C@H](O)CC2C3CCC4C[C@H](NC(C)=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C23H37NO2/c1-5-18-21(26)13-20-17-7-6-15-12-16(24-14(2)25)8-10-22(15,3)19(17)9-11-23(18,20)4/h5,15-17,19-21,26H,6-13H2,1-4H3,(H,24,25)/b18-5-/t15?,16-,17?,19?,20?,21-,22+,23-/m1/s1 |
| InChIKey | HRBVUQCOOVWRCT-JARPEMAPSA-N |
| XLogP | 4.45 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|