C32H46Cl2N2O3 — CID 10721907
[(3S,5S,8R,9S,10S,13S,14S,17S)-3-acetamido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-[bis(2-chloroethyl)amino]benzoate (PubChem CID 10721907) has the molecular formula C32H46Cl2N2O3 and a molecular weight of 577.64 g/mol. Its IUPAC name is [(3S,5S,8R,9S,10S,13S,14S,17S)-3-acetamido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-[bis(2-chloroethyl)amino]benzoate.
| Compound Name | [(3S,5S,8R,9S,10S,13S,14S,17S)-3-acetamido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-[bis(2-chloroethyl)amino]benzoate |
|---|---|
| PubChem CID | 10721907 |
| Molecular Formula | C32H46Cl2N2O3 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 576.29 |
| IUPAC Name | [(3S,5S,8R,9S,10S,13S,14S,17S)-3-acetamido-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] 4-[bis(2-chloroethyl)amino]benzoate |
| SMILES | CC(=O)N[C@H]1CC[C@@]2(C)[C@@H](CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H](OC(=O)c4ccc(N(CCCl)CCCl)cc4)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H46Cl2N2O3/c1-21(37)35-24-12-14-31(2)23(20-24)6-9-26-27-10-11-29(32(27,3)15-13-28(26)31)39-30(38)22-4-7-25(8-5-22)36(18-16-33)19-17-34/h4-5,7-8,23-24,26-29H,6,9-20H2,1-3H3,(H,35,37)/t23-,24-,26-,27-,28-,29-,31-,32-/m0/s1 |
| InChIKey | OVMQYZOYRXEFLL-NZUJPQRWSA-N |
| XLogP | 7.04 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|