C24H40Cl2NO6P — CID 99573514
[(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate (PubChem CID 99573514) has the molecular formula C24H40Cl2NO6P and a molecular weight of 540.47 g/mol. Its IUPAC name is [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate.
| Compound Name | [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate |
|---|---|
| PubChem CID | 99573514 |
| Molecular Formula | C24H40Cl2NO6P |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | [(3R,5R,8R,9S,10S,13S,14S,17S)-10,13-dimethyl-17-phosphonooxy-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] N,N-bis(2-chloroethyl)carbamate |
| SMILES | C[C@]12CC[C@@H](OC(=O)N(CCCl)CCCl)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OP(=O)(O)O)CC[C@@H]12 |
| InChI | InChI=1S/C24H40Cl2NO6P/c1-23-9-7-17(32-22(28)27(13-11-25)14-12-26)15-16(23)3-4-18-19-5-6-21(33-34(29,30)31)24(19,2)10-8-20(18)23/h16-21H,3-15H2,1-2H3,(H2,29,30,31)/t16-,17-,18+,19+,20+,21+,23+,24+/m1/s1 |
| InChIKey | AZSRKOWMDNSWGA-YKDNGQIQSA-N |
| XLogP | 5.79 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|